C18H18ClNO5 — CID 7274004
[2-(3-chloroanilino)-2-oxoethyl] 2-(4-ethoxyphenoxy)acetate (PubChem CID 7274004) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2-(4-ethoxyphenoxy)acetate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2-(4-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7274004 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2-(4-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccc(OCC(=O)OCC(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H18ClNO5/c1-2-23-15-6-8-16(9-7-15)24-12-18(22)25-11-17(21)20-14-5-3-4-13(19)10-14/h3-10H,2,11-12H2,1H3,(H,20,21) |
| InChIKey | JZGHPJOWMCOCAQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |