C17H16ClNO6S — CID 8982597
[2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(3-chlorophenoxy)acetate (PubChem CID 8982597) has the molecular formula C17H16ClNO6S and a molecular weight of 397.84 g/mol. Its IUPAC name is [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 8982597 |
| Molecular Formula | C17H16ClNO6S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(3-chlorophenoxy)acetate |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)COC(=O)COc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H16ClNO6S/c1-26(22,23)15-7-3-5-13(9-15)19-16(20)10-25-17(21)11-24-14-6-2-4-12(18)8-14/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | RAAZJNZUPHGLQH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |