C20H23NO7S — CID 8741259
[2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(2-propoxyphenoxy)acetate (PubChem CID 8741259) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(2-propoxyphenoxy)acetate.
| Compound Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(2-propoxyphenoxy)acetate |
|---|---|
| PubChem CID | 8741259 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(2-propoxyphenoxy)acetate |
| SMILES | CCCOc1ccccc1OCC(=O)OCC(=O)Nc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H23NO7S/c1-3-11-26-17-9-4-5-10-18(17)27-14-20(23)28-13-19(22)21-15-7-6-8-16(12-15)29(2,24)25/h4-10,12H,3,11,13-14H2,1-2H3,(H,21,22) |
| InChIKey | PKGHRLGCBOAPIU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |