C17H17NO5S2 — CID 8947661
[2-(3-methylsulfonylanilino)-2-oxoethyl] 2-phenylsulfanylacetate (PubChem CID 8947661) has the molecular formula C17H17NO5S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-phenylsulfanylacetate.
| Compound Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 8947661 |
| Molecular Formula | C17H17NO5S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-phenylsulfanylacetate |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)COC(=O)CSc2ccccc2)c1 |
| InChI | InChI=1S/C17H17NO5S2/c1-25(21,22)15-9-5-6-13(10-15)18-16(19)11-23-17(20)12-24-14-7-3-2-4-8-14/h2-10H,11-12H2,1H3,(H,18,19) |
| InChIKey | SGFPCOCVJIPEOS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |