C18H19NO4S — CID 2616661
[2-(4-ethoxyanilino)-2-oxoethyl] 2-phenylsulfanylacetate (PubChem CID 2616661) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 2-phenylsulfanylacetate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 2616661 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 2-phenylsulfanylacetate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)CSc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-2-22-15-10-8-14(9-11-15)19-17(20)12-23-18(21)13-24-16-6-4-3-5-7-16/h3-11H,2,12-13H2,1H3,(H,19,20) |
| InChIKey | YSOYJWJUDKOYIO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |