C21H25NO5S — CID 8970808
[2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(4-butylphenyl)acetate (PubChem CID 8970808) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(4-butylphenyl)acetate.
| Compound Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(4-butylphenyl)acetate |
|---|---|
| PubChem CID | 8970808 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 2-(4-butylphenyl)acetate |
| SMILES | CCCCc1ccc(CC(=O)OCC(=O)Nc2cccc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-3-4-6-16-9-11-17(12-10-16)13-21(24)27-15-20(23)22-18-7-5-8-19(14-18)28(2,25)26/h5,7-12,14H,3-4,6,13,15H2,1-2H3,(H,22,23) |
| InChIKey | CEPBUGUTLKGTJF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |