C18H18N2O5 — CID 8671933
[2-(3-acetamidoanilino)-2-oxoethyl] 2-(4-hydroxyphenyl)acetate (PubChem CID 8671933) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is [2-(3-acetamidoanilino)-2-oxoethyl] 2-(4-hydroxyphenyl)acetate.
| Compound Name | [2-(3-acetamidoanilino)-2-oxoethyl] 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 8671933 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [2-(3-acetamidoanilino)-2-oxoethyl] 2-(4-hydroxyphenyl)acetate |
| SMILES | CC(=O)Nc1cccc(NC(=O)COC(=O)Cc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C18H18N2O5/c1-12(21)19-14-3-2-4-15(10-14)20-17(23)11-25-18(24)9-13-5-7-16(22)8-6-13/h2-8,10,22H,9,11H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | VGQQUMQYSUIYMF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |