C16H17ClN2O2 — CID 160915382
N-(3-chlorophenyl)acetamide;N-phenylacetamide (PubChem CID 160915382) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)acetamide;N-phenylacetamide.
| Compound Name | N-(3-chlorophenyl)acetamide;N-phenylacetamide |
|---|---|
| PubChem CID | 160915382 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-(3-chlorophenyl)acetamide;N-phenylacetamide |
| SMILES | CC(=O)Nc1cccc(Cl)c1.CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C8H8ClNO.C8H9NO/c1-6(11)10-8-4-2-3-7(9)5-8;1-7(10)9-8-5-3-2-4-6-8/h2-5H,1H3,(H,10,11);2-6H,1H3,(H,9,10) |
| InChIKey | SRIHCDOZCHOIQX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |