C15H14ClN3O2S — CID 57262089
N-[4-[(3-chlorophenyl)carbamoyl-sulfanylamino]phenyl]acetamide (PubChem CID 57262089) has the molecular formula C15H14ClN3O2S and a molecular weight of 335.82 g/mol. Its IUPAC name is N-[4-[(3-chlorophenyl)carbamoyl-sulfanylamino]phenyl]acetamide.
| Compound Name | N-[4-[(3-chlorophenyl)carbamoyl-sulfanylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 57262089 |
| Molecular Formula | C15H14ClN3O2S |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[4-[(3-chlorophenyl)carbamoyl-sulfanylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(S)C(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14ClN3O2S/c1-10(20)17-12-5-7-14(8-6-12)19(22)15(21)18-13-4-2-3-11(16)9-13/h2-9,22H,1H3,(H,17,20)(H,18,21) |
| InChIKey | QFODJMDOMRYKMC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|