C21H16ClF2N3O2S — CID 57291327
N-[4-[(3-chloro-4-methylphenyl)carbamoyl-sulfanylamino]phenyl]-2,6-difluorobenzamide (PubChem CID 57291327) has the molecular formula C21H16ClF2N3O2S and a molecular weight of 447.89 g/mol. Its IUPAC name is N-[4-[(3-chloro-4-methylphenyl)carbamoyl-sulfanylamino]phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[4-[(3-chloro-4-methylphenyl)carbamoyl-sulfanylamino]phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 57291327 |
| Molecular Formula | C21H16ClF2N3O2S |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | N-[4-[(3-chloro-4-methylphenyl)carbamoyl-sulfanylamino]phenyl]-2,6-difluorobenzamide |
| SMILES | Cc1ccc(NC(=O)N(S)c2ccc(NC(=O)c3c(F)cccc3F)cc2)cc1Cl |
| InChI | InChI=1S/C21H16ClF2N3O2S/c1-12-5-6-14(11-16(12)22)26-21(29)27(30)15-9-7-13(8-10-15)25-20(28)19-17(23)3-2-4-18(19)24/h2-11,30H,1H3,(H,25,28)(H,26,29) |
| InChIKey | AJHSZLVOZJGDNA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|