C21H16ClF2N3O2S2 — CID 57085382
N-[4-[(3-chloro-4-methylsulfanylphenyl)carbamoyl-sulfanylamino]phenyl]-2,6-difluorobenzamide (PubChem CID 57085382) has the molecular formula C21H16ClF2N3O2S2 and a molecular weight of 479.96 g/mol. Its IUPAC name is N-[4-[(3-chloro-4-methylsulfanylphenyl)carbamoyl-sulfanylamino]phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[4-[(3-chloro-4-methylsulfanylphenyl)carbamoyl-sulfanylamino]phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 57085382 |
| Molecular Formula | C21H16ClF2N3O2S2 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | N-[4-[(3-chloro-4-methylsulfanylphenyl)carbamoyl-sulfanylamino]phenyl]-2,6-difluorobenzamide |
| SMILES | CSc1ccc(NC(=O)N(S)c2ccc(NC(=O)c3c(F)cccc3F)cc2)cc1Cl |
| InChI | InChI=1S/C21H16ClF2N3O2S2/c1-31-18-10-7-13(11-15(18)22)26-21(29)27(30)14-8-5-12(6-9-14)25-20(28)19-16(23)3-2-4-17(19)24/h2-11,30H,1H3,(H,25,28)(H,26,29) |
| InChIKey | SGCIENVJSUONNG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|