C16H13ClF3N3O2S — CID 57061867
N-[4-[[3-chloro-4-(trifluoromethyl)phenyl]carbamoyl-sulfanylamino]phenyl]acetamide (PubChem CID 57061867) has the molecular formula C16H13ClF3N3O2S and a molecular weight of 403.81 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-(trifluoromethyl)phenyl]carbamoyl-sulfanylamino]phenyl]acetamide.
| Compound Name | N-[4-[[3-chloro-4-(trifluoromethyl)phenyl]carbamoyl-sulfanylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 57061867 |
| Molecular Formula | C16H13ClF3N3O2S |
| Molecular Weight | 403.81 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | N-[4-[[3-chloro-4-(trifluoromethyl)phenyl]carbamoyl-sulfanylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(S)C(=O)Nc2ccc(C(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H13ClF3N3O2S/c1-9(24)21-10-2-5-12(6-3-10)23(26)15(25)22-11-4-7-13(14(17)8-11)16(18,19)20/h2-8,26H,1H3,(H,21,24)(H,22,25) |
| InChIKey | QGOQWQBIGUZGAC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.81 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|