C17H18ClN3O3S — CID 56994150
N-[4-[(3-chloro-4-methoxy-5-methylphenyl)carbamoyl-sulfanylamino]phenyl]acetamide (PubChem CID 56994150) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is N-[4-[(3-chloro-4-methoxy-5-methylphenyl)carbamoyl-sulfanylamino]phenyl]acetamide.
| Compound Name | N-[4-[(3-chloro-4-methoxy-5-methylphenyl)carbamoyl-sulfanylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 56994150 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[4-[(3-chloro-4-methoxy-5-methylphenyl)carbamoyl-sulfanylamino]phenyl]acetamide |
| SMILES | COc1c(C)cc(NC(=O)N(S)c2ccc(NC(C)=O)cc2)cc1Cl |
| InChI | InChI=1S/C17H18ClN3O3S/c1-10-8-13(9-15(18)16(10)24-3)20-17(23)21(25)14-6-4-12(5-7-14)19-11(2)22/h4-9,25H,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | SOSHZBAMUVRNJT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|