C17H18FN3O4S — CID 57222382
N-[4-[(5-fluoro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]acetamide (PubChem CID 57222382) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[4-[(5-fluoro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]acetamide.
| Compound Name | N-[4-[(5-fluoro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 57222382 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[4-[(5-fluoro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]acetamide |
| SMILES | COc1cc(OC)c(NC(=O)N(S)c2ccc(NC(C)=O)cc2)cc1F |
| InChI | InChI=1S/C17H18FN3O4S/c1-10(22)19-11-4-6-12(7-5-11)21(26)17(23)20-14-8-13(18)15(24-2)9-16(14)25-3/h4-9,26H,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | SWGFAORIVHSMBN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|