C23H24N4O3S — CID 57267742
N-[4-[[2-(benzylamino)-4-methoxyphenyl]carbamoyl-sulfanylamino]phenyl]acetamide (PubChem CID 57267742) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[4-[[2-(benzylamino)-4-methoxyphenyl]carbamoyl-sulfanylamino]phenyl]acetamide.
| Compound Name | N-[4-[[2-(benzylamino)-4-methoxyphenyl]carbamoyl-sulfanylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 57267742 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[4-[[2-(benzylamino)-4-methoxyphenyl]carbamoyl-sulfanylamino]phenyl]acetamide |
| SMILES | COc1ccc(NC(=O)N(S)c2ccc(NC(C)=O)cc2)c(NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N4O3S/c1-16(28)25-18-8-10-19(11-9-18)27(31)23(29)26-21-13-12-20(30-2)14-22(21)24-15-17-6-4-3-5-7-17/h3-14,24,31H,15H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | JEFPWMXKVKNASZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|