C22H19ClN4O3S — CID 57049260
N-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chlorophenyl]benzamide (PubChem CID 57049260) has the molecular formula C22H19ClN4O3S and a molecular weight of 454.94 g/mol. Its IUPAC name is N-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chlorophenyl]benzamide.
| Compound Name | N-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chlorophenyl]benzamide |
|---|---|
| PubChem CID | 57049260 |
| Molecular Formula | C22H19ClN4O3S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chlorophenyl]benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)N(S)c2ccc(NC(=O)c3ccccc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H19ClN4O3S/c1-14(28)24-16-7-9-17(10-8-16)25-22(30)27(31)18-11-12-20(19(23)13-18)26-21(29)15-5-3-2-4-6-15/h2-13,31H,1H3,(H,24,28)(H,25,30)(H,26,29) |
| InChIKey | GLPXNNALUYDCEE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|