C20H23ClN4O2S — CID 57178259
N-[4-[(3-chloro-4-piperidin-1-ylphenyl)carbamoyl-sulfanylamino]phenyl]acetamide (PubChem CID 57178259) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is N-[4-[(3-chloro-4-piperidin-1-ylphenyl)carbamoyl-sulfanylamino]phenyl]acetamide.
| Compound Name | N-[4-[(3-chloro-4-piperidin-1-ylphenyl)carbamoyl-sulfanylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 57178259 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[4-[(3-chloro-4-piperidin-1-ylphenyl)carbamoyl-sulfanylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(S)C(=O)Nc2ccc(N3CCCCC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23ClN4O2S/c1-14(26)22-15-5-8-17(9-6-15)25(28)20(27)23-16-7-10-19(18(21)13-16)24-11-3-2-4-12-24/h5-10,13,28H,2-4,11-12H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | BEXKJEGZAXVRIF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|