C22H28ClN5O2S — CID 57184489
N-[4-[[3-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]phenyl]carbamoyl-sulfanylamino]phenyl]acetamide (PubChem CID 57184489) has the molecular formula C22H28ClN5O2S and a molecular weight of 462.02 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]phenyl]carbamoyl-sulfanylamino]phenyl]acetamide.
| Compound Name | N-[4-[[3-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]phenyl]carbamoyl-sulfanylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 57184489 |
| Molecular Formula | C22H28ClN5O2S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[4-[[3-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]phenyl]carbamoyl-sulfanylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(S)C(=O)Nc2ccc(N(C)C3CCN(C)CC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H28ClN5O2S/c1-15(29)24-16-4-7-19(8-5-16)28(31)22(30)25-17-6-9-21(20(23)14-17)27(3)18-10-12-26(2)13-11-18/h4-9,14,18,31H,10-13H2,1-3H3,(H,24,29)(H,25,30) |
| InChIKey | OVWHPIMUPZECNB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|