C17H18ClN3O4S — CID 57074482
N-[4-[[3-chloro-4-(2-hydroxyethoxy)phenyl]carbamoyl-sulfanylamino]phenyl]acetamide (PubChem CID 57074482) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-(2-hydroxyethoxy)phenyl]carbamoyl-sulfanylamino]phenyl]acetamide.
| Compound Name | N-[4-[[3-chloro-4-(2-hydroxyethoxy)phenyl]carbamoyl-sulfanylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 57074482 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-[4-[[3-chloro-4-(2-hydroxyethoxy)phenyl]carbamoyl-sulfanylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(S)C(=O)Nc2ccc(OCCO)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H18ClN3O4S/c1-11(23)19-12-2-5-14(6-3-12)21(26)17(24)20-13-4-7-16(15(18)10-13)25-9-8-22/h2-7,10,22,26H,8-9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | OUUQSBMNHUFZGX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|