C15H21ClN2O3 — CID 110896948
3-(3-chloro-4-propoxyphenyl)-1-cyclopropyl-1-(2-hydroxyethyl)urea (PubChem CID 110896948) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 3-(3-chloro-4-propoxyphenyl)-1-cyclopropyl-1-(2-hydroxyethyl)urea.
| Compound Name | 3-(3-chloro-4-propoxyphenyl)-1-cyclopropyl-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110896948 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-(3-chloro-4-propoxyphenyl)-1-cyclopropyl-1-(2-hydroxyethyl)urea |
| SMILES | CCCOc1ccc(NC(=O)N(CCO)C2CC2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O3/c1-2-9-21-14-6-3-11(10-13(14)16)17-15(20)18(7-8-19)12-4-5-12/h3,6,10,12,19H,2,4-5,7-9H2,1H3,(H,17,20) |
| InChIKey | VMYBKZCUFZMMEA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |