C20H23ClN4O2S — CID 15954898
N-[4-[[3-chloro-4-(1-methylpyrrolidin-3-yl)oxyphenyl]carbamothioylamino]phenyl]acetamide (PubChem CID 15954898) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-(1-methylpyrrolidin-3-yl)oxyphenyl]carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[[3-chloro-4-(1-methylpyrrolidin-3-yl)oxyphenyl]carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 15954898 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[4-[[3-chloro-4-(1-methylpyrrolidin-3-yl)oxyphenyl]carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2ccc(OC3CCN(C)C3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23ClN4O2S/c1-13(26)22-14-3-5-15(6-4-14)23-20(28)24-16-7-8-19(18(21)11-16)27-17-9-10-25(2)12-17/h3-8,11,17H,9-10,12H2,1-2H3,(H,22,26)(H2,23,24,28) |
| InChIKey | SXPLSYRTGBXNSW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|