C19H22ClN3O2S — CID 15954864
N-[4-[(4-butan-2-yloxy-3-chlorophenyl)carbamothioylamino]phenyl]acetamide (PubChem CID 15954864) has the molecular formula C19H22ClN3O2S and a molecular weight of 391.92 g/mol. Its IUPAC name is N-[4-[(4-butan-2-yloxy-3-chlorophenyl)carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[(4-butan-2-yloxy-3-chlorophenyl)carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 15954864 |
| Molecular Formula | C19H22ClN3O2S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[4-[(4-butan-2-yloxy-3-chlorophenyl)carbamothioylamino]phenyl]acetamide |
| SMILES | CCC(C)Oc1ccc(NC(=S)Nc2ccc(NC(C)=O)cc2)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O2S/c1-4-12(2)25-18-10-9-16(11-17(18)20)23-19(26)22-15-7-5-14(6-8-15)21-13(3)24/h5-12H,4H2,1-3H3,(H,21,24)(H2,22,23,26) |
| InChIKey | KXRPODARNOZDIC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|