C15H13BrClN3OS — CID 15954823
N-[4-[(4-bromo-3-chlorophenyl)carbamothioylamino]phenyl]acetamide (PubChem CID 15954823) has the molecular formula C15H13BrClN3OS and a molecular weight of 398.71 g/mol. Its IUPAC name is N-[4-[(4-bromo-3-chlorophenyl)carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[(4-bromo-3-chlorophenyl)carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 15954823 |
| Molecular Formula | C15H13BrClN3OS |
| Molecular Weight | 398.71 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | N-[4-[(4-bromo-3-chlorophenyl)carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2ccc(Br)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H13BrClN3OS/c1-9(21)18-10-2-4-11(5-3-10)19-15(22)20-12-6-7-13(16)14(17)8-12/h2-8H,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | BWNPCGXFQSTPIN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|