C18H19BrClN3O2S — CID 3719622
N-[3-[3-[(4-bromo-3-chlorophenyl)carbamothioylamino]propoxy]phenyl]acetamide (PubChem CID 3719622) has the molecular formula C18H19BrClN3O2S and a molecular weight of 456.79 g/mol. Its IUPAC name is N-[3-[3-[(4-bromo-3-chlorophenyl)carbamothioylamino]propoxy]phenyl]acetamide.
| Compound Name | N-[3-[3-[(4-bromo-3-chlorophenyl)carbamothioylamino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 3719622 |
| Molecular Formula | C18H19BrClN3O2S |
| Molecular Weight | 456.79 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | N-[3-[3-[(4-bromo-3-chlorophenyl)carbamothioylamino]propoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(OCCCNC(=S)Nc2ccc(Br)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H19BrClN3O2S/c1-12(24)22-13-4-2-5-15(10-13)25-9-3-8-21-18(26)23-14-6-7-16(19)17(20)11-14/h2,4-7,10-11H,3,8-9H2,1H3,(H,22,24)(H2,21,23,26) |
| InChIKey | VVVLXEITNXMBQJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.79 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|