C20H25BrN4OS2 — CID 25126667
1-(4-bromophenyl)-3-[6-[3-(carbamothioylamino)phenoxy]hexyl]thiourea (PubChem CID 25126667) has the molecular formula C20H25BrN4OS2 and a molecular weight of 481.49 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[6-[3-(carbamothioylamino)phenoxy]hexyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[6-[3-(carbamothioylamino)phenoxy]hexyl]thiourea |
|---|---|
| PubChem CID | 25126667 |
| Molecular Formula | C20H25BrN4OS2 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 1-(4-bromophenyl)-3-[6-[3-(carbamothioylamino)phenoxy]hexyl]thiourea |
| SMILES | NC(=S)Nc1cccc(OCCCCCCNC(=S)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H25BrN4OS2/c21-15-8-10-16(11-9-15)25-20(28)23-12-3-1-2-4-13-26-18-7-5-6-17(14-18)24-19(22)27/h5-11,14H,1-4,12-13H2,(H3,22,24,27)(H2,23,25,28) |
| InChIKey | DSQWVCTXGRKEAR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|