C24H34N4OS2 — CID 25127312
1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 25127312) has the molecular formula C24H34N4OS2 and a molecular weight of 458.70 g/mol. Its IUPAC name is 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 25127312 |
| Molecular Formula | C24H34N4OS2 |
| Molecular Weight | 458.70 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NCCCCCCCCOc2cccc(NC(N)=S)c2)c1 |
| InChI | InChI=1S/C24H34N4OS2/c1-18-14-19(2)16-21(15-18)28-24(31)26-12-7-5-3-4-6-8-13-29-22-11-9-10-20(17-22)27-23(25)30/h9-11,14-17H,3-8,12-13H2,1-2H3,(H3,25,27,30)(H2,26,28,31) |
| InChIKey | AVUWWMAHOSENJG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|