C22H28Cl2N4OS2 — CID 25128278
1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-(2,4-dichlorophenyl)thiourea (PubChem CID 25128278) has the molecular formula C22H28Cl2N4OS2 and a molecular weight of 499.53 g/mol. Its IUPAC name is 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-(2,4-dichlorophenyl)thiourea.
| Compound Name | 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-(2,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 25128278 |
| Molecular Formula | C22H28Cl2N4OS2 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-(2,4-dichlorophenyl)thiourea |
| SMILES | NC(=S)Nc1cccc(OCCCCCCCCNC(=S)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C22H28Cl2N4OS2/c23-16-10-11-20(19(24)14-16)28-22(31)26-12-5-3-1-2-4-6-13-29-18-9-7-8-17(15-18)27-21(25)30/h7-11,14-15H,1-6,12-13H2,(H3,25,27,30)(H2,26,28,31) |
| InChIKey | QMTAYCIUWRCLRI-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|