C16H16Cl2N2OS — CID 8615071
1-[2-(2,4-dichlorophenyl)ethyl]-3-(3-methoxyphenyl)thiourea (PubChem CID 8615071) has the molecular formula C16H16Cl2N2OS and a molecular weight of 355.29 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)ethyl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[2-(2,4-dichlorophenyl)ethyl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8615071 |
| Molecular Formula | C16H16Cl2N2OS |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)ethyl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)NCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2OS/c1-21-14-4-2-3-13(10-14)20-16(22)19-8-7-11-5-6-12(17)9-15(11)18/h2-6,9-10H,7-8H2,1H3,(H2,19,20,22) |
| InChIKey | KTDFAKMFISQQMN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|