C17H17F3N2OS — CID 3596467
1-(3-methoxyphenyl)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]thiourea (PubChem CID 3596467) has the molecular formula C17H17F3N2OS and a molecular weight of 354.40 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 3596467 |
| Molecular Formula | C17H17F3N2OS |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]thiourea |
| SMILES | COc1cccc(NC(=S)NCCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H17F3N2OS/c1-23-15-7-3-6-14(11-15)22-16(24)21-9-8-12-4-2-5-13(10-12)17(18,19)20/h2-7,10-11H,8-9H2,1H3,(H2,21,22,24) |
| InChIKey | HXRKBFJGTZUNMG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|