C18H20F3N3S — CID 5092422
1-[4-(dimethylamino)phenyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]thiourea (PubChem CID 5092422) has the molecular formula C18H20F3N3S and a molecular weight of 367.44 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]thiourea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 5092422 |
| Molecular Formula | C18H20F3N3S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]thiourea |
| SMILES | CN(C)c1ccc(NC(=S)NCCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H20F3N3S/c1-24(2)16-8-6-15(7-9-16)23-17(25)22-11-10-13-4-3-5-14(12-13)18(19,20)21/h3-9,12H,10-11H2,1-2H3,(H2,22,23,25) |
| InChIKey | VJXLFUWZDXASHS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|