C20H24F3N3S — CID 2796659
1-[[4-(dimethylamino)phenyl]methyl]-1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 2796659) has the molecular formula C20H24F3N3S and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2796659 |
| Molecular Formula | C20H24F3N3S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC(C)N(Cc1ccc(N(C)C)cc1)C(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H24F3N3S/c1-14(2)26(13-15-8-10-18(11-9-15)25(3)4)19(27)24-17-7-5-6-16(12-17)20(21,22)23/h5-12,14H,13H2,1-4H3,(H,24,27) |
| InChIKey | SVHUQEACYVPKCC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|