C19H21F3N2S — CID 3594293
1-[2-[3-(trifluoromethyl)phenyl]ethyl]-3-(2,4,5-trimethylphenyl)thiourea (PubChem CID 3594293) has the molecular formula C19H21F3N2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[2-[3-(trifluoromethyl)phenyl]ethyl]-3-(2,4,5-trimethylphenyl)thiourea.
| Compound Name | 1-[2-[3-(trifluoromethyl)phenyl]ethyl]-3-(2,4,5-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 3594293 |
| Molecular Formula | C19H21F3N2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-[2-[3-(trifluoromethyl)phenyl]ethyl]-3-(2,4,5-trimethylphenyl)thiourea |
| SMILES | Cc1cc(C)c(NC(=S)NCCc2cccc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C19H21F3N2S/c1-12-9-14(3)17(10-13(12)2)24-18(25)23-8-7-15-5-4-6-16(11-15)19(20,21)22/h4-6,9-11H,7-8H2,1-3H3,(H2,23,24,25) |
| InChIKey | UTAYIDWDGHVYTR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|