C11H13F3N2S — CID 35766929
1-ethyl-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 35766929) has the molecular formula C11H13F3N2S and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-ethyl-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-ethyl-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 35766929 |
| Molecular Formula | C11H13F3N2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-ethyl-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | CCNC(=S)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2S/c1-2-15-10(17)16-7-8-4-3-5-9(6-8)11(12,13)14/h3-6H,2,7H2,1H3,(H2,15,16,17) |
| InChIKey | XIQNEMBMXAZZEC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|