C11H13F3N2OS — CID 12622964
1-(2-hydroxyethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 12622964) has the molecular formula C11H13F3N2OS and a molecular weight of 278.30 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(2-hydroxyethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 12622964 |
| Molecular Formula | C11H13F3N2OS |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | OCCNC(=S)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2OS/c12-11(13,14)9-3-1-2-8(6-9)7-16-10(18)15-4-5-17/h1-3,6,17H,4-5,7H2,(H2,15,16,18) |
| InChIKey | LKQYGRPITHCZCO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|