C14H12F3N3S — CID 2807300
1-(pyridin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 2807300) has the molecular formula C14H12F3N3S and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2807300 |
| Molecular Formula | C14H12F3N3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cccc(NC(=S)NCc2ccncc2)c1 |
| InChI | InChI=1S/C14H12F3N3S/c15-14(16,17)11-2-1-3-12(8-11)20-13(21)19-9-10-4-6-18-7-5-10/h1-8H,9H2,(H2,19,20,21) |
| InChIKey | JCQQTISWCKGPHY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|