C20H16F3N3O — CID 10248635
1-[4-(pyridin-4-ylmethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 10248635) has the molecular formula C20H16F3N3O and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-[4-(pyridin-4-ylmethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(pyridin-4-ylmethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 10248635 |
| Molecular Formula | C20H16F3N3O |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-[4-(pyridin-4-ylmethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cc2ccncc2)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3N3O/c21-20(22,23)16-2-1-3-18(13-16)26-19(27)25-17-6-4-14(5-7-17)12-15-8-10-24-11-9-15/h1-11,13H,12H2,(H2,25,26,27) |
| InChIKey | DPEYZCWXXUHPDG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |