C26H23F3N4O2 — CID 162555731
1-[4-[3-hydroxy-3-(isoquinolin-6-ylamino)propyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 162555731) has the molecular formula C26H23F3N4O2 and a molecular weight of 480.49 g/mol. Its IUPAC name is 1-[4-[3-hydroxy-3-(isoquinolin-6-ylamino)propyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[3-hydroxy-3-(isoquinolin-6-ylamino)propyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 162555731 |
| Molecular Formula | C26H23F3N4O2 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1-[4-[3-hydroxy-3-(isoquinolin-6-ylamino)propyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(CCC(O)Nc2ccc3cnccc3c2)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H23F3N4O2/c27-26(28,29)20-2-1-3-22(15-20)33-25(35)32-21-8-4-17(5-9-21)6-11-24(34)31-23-10-7-19-16-30-13-12-18(19)14-23/h1-5,7-10,12-16,24,31,34H,6,11H2,(H2,32,33,35) |
| InChIKey | ZXVXBBJARKFSJT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|