C13H11F3N4O — CID 63063127
1-(3-amino-4-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 63063127) has the molecular formula C13H11F3N4O and a molecular weight of 296.25 g/mol. Its IUPAC name is 1-(3-amino-4-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-amino-4-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 63063127 |
| Molecular Formula | C13H11F3N4O |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-(3-amino-4-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Nc1cnccc1NC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3N4O/c14-13(15,16)8-2-1-3-9(6-8)19-12(21)20-11-4-5-18-7-10(11)17/h1-7H,17H2,(H2,18,19,20,21) |
| InChIKey | KFBHIWDIGAYLDN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |