C14H9F6N3O — CID 108865005
1-[3,5-bis(trifluoromethyl)phenyl]-3-pyridin-3-ylurea (PubChem CID 108865005) has the molecular formula C14H9F6N3O and a molecular weight of 349.23 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 108865005 |
| Molecular Formula | C14H9F6N3O |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1cccnc1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F6N3O/c15-13(16,17)8-4-9(14(18,19)20)6-11(5-8)23-12(24)22-10-2-1-3-21-7-10/h1-7H,(H2,22,23,24) |
| InChIKey | VRWKJLKTRYSSJY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |