C15H11F6N3O — CID 108897036
1-(4-aminophenyl)-3-[3,5-bis(trifluoromethyl)phenyl]urea (PubChem CID 108897036) has the molecular formula C15H11F6N3O and a molecular weight of 363.26 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[3,5-bis(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-aminophenyl)-3-[3,5-bis(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108897036 |
| Molecular Formula | C15H11F6N3O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-(4-aminophenyl)-3-[3,5-bis(trifluoromethyl)phenyl]urea |
| SMILES | Nc1ccc(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H11F6N3O/c16-14(17,18)8-5-9(15(19,20)21)7-12(6-8)24-13(25)23-11-3-1-10(22)2-4-11/h1-7H,22H2,(H2,23,24,25) |
| InChIKey | VVJNSRGBQORTRI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|