C20H13F6N7O — CID 23154952
1-[4-(6-aminopurin-9-yl)phenyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea (PubChem CID 23154952) has the molecular formula C20H13F6N7O and a molecular weight of 481.36 g/mol. Its IUPAC name is 1-[4-(6-aminopurin-9-yl)phenyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(6-aminopurin-9-yl)phenyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 23154952 |
| Molecular Formula | C20H13F6N7O |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 1-[4-(6-aminopurin-9-yl)phenyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea |
| SMILES | Nc1ncnc2c1ncn2-c1ccc(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H13F6N7O/c21-19(22,23)10-5-11(20(24,25)26)7-13(6-10)32-18(34)31-12-1-3-14(4-2-12)33-9-30-15-16(27)28-8-29-17(15)33/h1-9H,(H2,27,28,29)(H2,31,32,34) |
| InChIKey | CYYWTPIRBBOOJR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |