C21H18ClF3N8O — CID 23154993
1-[4-[6-(2-aminoethylamino)purin-9-yl]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 23154993) has the molecular formula C21H18ClF3N8O and a molecular weight of 490.88 g/mol. Its IUPAC name is 1-[4-[6-(2-aminoethylamino)purin-9-yl]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[6-(2-aminoethylamino)purin-9-yl]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 23154993 |
| Molecular Formula | C21H18ClF3N8O |
| Molecular Weight | 490.88 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 1-[4-[6-(2-aminoethylamino)purin-9-yl]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | NCCNc1ncnc2c1ncn2-c1ccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H18ClF3N8O/c22-16-6-3-13(9-15(16)21(23,24)25)32-20(34)31-12-1-4-14(5-2-12)33-11-30-17-18(27-8-7-26)28-10-29-19(17)33/h1-6,9-11H,7-8,26H2,(H,27,28,29)(H2,31,32,34) |
| InChIKey | AEXZWGVXJATXKL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |