C20H15ClF3N7O2 — CID 23155055
3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-[4-[6-(methylamino)purin-9-yl]phenyl]urea (PubChem CID 23155055) has the molecular formula C20H15ClF3N7O2 and a molecular weight of 477.83 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-[4-[6-(methylamino)purin-9-yl]phenyl]urea.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-[4-[6-(methylamino)purin-9-yl]phenyl]urea |
|---|---|
| PubChem CID | 23155055 |
| Molecular Formula | C20H15ClF3N7O2 |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-[4-[6-(methylamino)purin-9-yl]phenyl]urea |
| SMILES | CNc1ncnc2c1ncn2-c1ccc(N(O)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H15ClF3N7O2/c1-25-17-16-18(27-9-26-17)30(10-28-16)12-3-5-13(6-4-12)31(33)19(32)29-11-2-7-15(21)14(8-11)20(22,23)24/h2-10,33H,1H3,(H,29,32)(H,25,26,27) |
| InChIKey | PTTMXCNJRZQNKY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|