C25H28F3N9O — CID 23155005
1-[4-[[2-(dimethylamino)ethylamino]methyl]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea (PubChem CID 23155005) has the molecular formula C25H28F3N9O and a molecular weight of 527.56 g/mol. Its IUPAC name is 1-[4-[[2-(dimethylamino)ethylamino]methyl]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea.
| Compound Name | 1-[4-[[2-(dimethylamino)ethylamino]methyl]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea |
|---|---|
| PubChem CID | 23155005 |
| Molecular Formula | C25H28F3N9O |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 1-[4-[[2-(dimethylamino)ethylamino]methyl]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea |
| SMILES | CNc1ncnc2c1ncn2-c1ccc(NC(=O)Nc2ccc(CNCCN(C)C)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H28F3N9O/c1-29-22-21-23(32-14-31-22)37(15-33-21)19-8-6-17(7-9-19)34-24(38)35-18-5-4-16(13-30-10-11-36(2)3)20(12-18)25(26,27)28/h4-9,12,14-15,30H,10-11,13H2,1-3H3,(H,29,31,32)(H2,34,35,38) |
| InChIKey | HJXPESDAGWBUFI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|