C27H30F3N9O — CID 23155277
1-[4-[6-(methylamino)purin-9-yl]phenyl]-3-[4-[(2-pyrrolidin-1-ylethylamino)methyl]-3-(trifluoromethyl)phenyl]urea (PubChem CID 23155277) has the molecular formula C27H30F3N9O and a molecular weight of 553.59 g/mol. Its IUPAC name is 1-[4-[6-(methylamino)purin-9-yl]phenyl]-3-[4-[(2-pyrrolidin-1-ylethylamino)methyl]-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[6-(methylamino)purin-9-yl]phenyl]-3-[4-[(2-pyrrolidin-1-ylethylamino)methyl]-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 23155277 |
| Molecular Formula | C27H30F3N9O |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 1-[4-[6-(methylamino)purin-9-yl]phenyl]-3-[4-[(2-pyrrolidin-1-ylethylamino)methyl]-3-(trifluoromethyl)phenyl]urea |
| SMILES | CNc1ncnc2c1ncn2-c1ccc(NC(=O)Nc2ccc(CNCCN3CCCC3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H30F3N9O/c1-31-24-23-25(34-16-33-24)39(17-35-23)21-8-6-19(7-9-21)36-26(40)37-20-5-4-18(22(14-20)27(28,29)30)15-32-10-13-38-11-2-3-12-38/h4-9,14,16-17,32H,2-3,10-13,15H2,1H3,(H,31,33,34)(H2,36,37,40) |
| InChIKey | JLEHCBCDDATLIQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|