C28H34F3N9O — CID 23154917
1-[4-[2-[4-(dimethylamino)butylamino]ethyl]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea (PubChem CID 23154917) has the molecular formula C28H34F3N9O and a molecular weight of 569.64 g/mol. Its IUPAC name is 1-[4-[2-[4-(dimethylamino)butylamino]ethyl]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea.
| Compound Name | 1-[4-[2-[4-(dimethylamino)butylamino]ethyl]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea |
|---|---|
| PubChem CID | 23154917 |
| Molecular Formula | C28H34F3N9O |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | 1-[4-[2-[4-(dimethylamino)butylamino]ethyl]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea |
| SMILES | CNc1ncnc2c1ncn2-c1ccc(NC(=O)Nc2ccc(CCNCCCCN(C)C)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C28H34F3N9O/c1-32-25-24-26(35-17-34-25)40(18-36-24)22-10-8-20(9-11-22)37-27(41)38-21-7-6-19(23(16-21)28(29,30)31)12-14-33-13-4-5-15-39(2)3/h6-11,16-18,33H,4-5,12-15H2,1-3H3,(H,32,34,35)(H2,37,38,41) |
| InChIKey | AWDPFBICLORWQN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|