C25H26F3N7O4 — CID 23155141
1-[4-[2-(2-methoxyethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea (PubChem CID 23155141) has the molecular formula C25H26F3N7O4 and a molecular weight of 545.52 g/mol. Its IUPAC name is 1-[4-[2-(2-methoxyethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea.
| Compound Name | 1-[4-[2-(2-methoxyethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea |
|---|---|
| PubChem CID | 23155141 |
| Molecular Formula | C25H26F3N7O4 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 1-[4-[2-(2-methoxyethoxy)ethoxy]-3-(trifluoromethyl)phenyl]-3-[4-[6-(methylamino)purin-9-yl]phenyl]urea |
| SMILES | CNc1ncnc2c1ncn2-c1ccc(NC(=O)Nc2ccc(OCCOCCOC)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H26F3N7O4/c1-29-22-21-23(31-14-30-22)35(15-32-21)18-6-3-16(4-7-18)33-24(36)34-17-5-8-20(19(13-17)25(26,27)28)39-12-11-38-10-9-37-2/h3-8,13-15H,9-12H2,1-2H3,(H,29,30,31)(H2,33,34,36) |
| InChIKey | AIEHRKZCEYCLSG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|