C20H13ClF3N5O2 — CID 23155203
3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-(4-imidazo[4,5-b]pyridin-1-ylphenyl)urea (PubChem CID 23155203) has the molecular formula C20H13ClF3N5O2 and a molecular weight of 447.80 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-(4-imidazo[4,5-b]pyridin-1-ylphenyl)urea.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-(4-imidazo[4,5-b]pyridin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 23155203 |
| Molecular Formula | C20H13ClF3N5O2 |
| Molecular Weight | 447.80 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-(4-imidazo[4,5-b]pyridin-1-ylphenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)N(O)c1ccc(-n2cnc3ncccc32)cc1 |
| InChI | InChI=1S/C20H13ClF3N5O2/c21-16-8-3-12(10-15(16)20(22,23)24)27-19(30)29(31)14-6-4-13(5-7-14)28-11-26-18-17(28)2-1-9-25-18/h1-11,31H,(H,27,30) |
| InChIKey | FTCVIVRFVCNDRR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.80 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|