C27H24ClF3N4O4 — CID 59725979
tert-butyl N-[1-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl-hydroxyamino]phenyl]indol-5-yl]carbamate (PubChem CID 59725979) has the molecular formula C27H24ClF3N4O4 and a molecular weight of 560.96 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl-hydroxyamino]phenyl]indol-5-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl-hydroxyamino]phenyl]indol-5-yl]carbamate |
|---|---|
| PubChem CID | 59725979 |
| Molecular Formula | C27H24ClF3N4O4 |
| Molecular Weight | 560.96 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | tert-butyl N-[1-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl-hydroxyamino]phenyl]indol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc2c(ccn2-c2ccc(N(O)C(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)c1 |
| InChI | InChI=1S/C27H24ClF3N4O4/c1-26(2,3)39-25(37)33-17-5-11-23-16(14-17)12-13-34(23)19-6-8-20(9-7-19)35(38)24(36)32-18-4-10-22(28)21(15-18)27(29,30)31/h4-15,38H,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | GNAVESBCLAMVTH-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.96 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|