C14H17F3N2O3 — CID 56827231
tert-butyl N-[4-acetamido-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 56827231) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is tert-butyl N-[4-acetamido-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-acetamido-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 56827231 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | tert-butyl N-[4-acetamido-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(=O)Nc1ccc(NC(=O)OC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O3/c1-8(20)18-11-6-5-9(7-10(11)14(15,16)17)19-12(21)22-13(2,3)4/h5-7H,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | ODWFEESIQFBVIU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |